35817-27-7 4-Ethoxycumarin
Produkt-Name |
4-Ethoxycumarin |
Synonyme |
4-Ethoxy-2H-chromen-2-on |
Englischer Name |
4-Ethoxycoumarin;4-ethoxy-2H-chromen-2-one |
Molekulare Formel |
C11H10O3 |
Molecular Weight |
190.1953 |
InChI |
InChI=1/C11H10O3/c1-2-13-10-7-11(12)14-9-6-4-3-5-8(9)10/h3-7H,2H2,1H3 |
CAS Registry Number |
35817-27-7 |
Molecular Structure |
|
Dichte |
1.21g/cm3 |
Siedepunkt |
356.2°C at 760 mmHg |
Brechungsindex |
1.569 |
Flammpunkt |
148.4°C |
Dampfdruck |
2.97E-05mmHg at 25°C |
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|