ChemNet > CAS > 36140-83-7 1-Cyanoacetyl-3,5-dimethylpyrazole
36140-83-7 1-Cyanoacetyl-3,5-dimethylpyrazole
| Produkt-Name |
1-Cyanoacetyl-3,5-dimethylpyrazole |
| Englischer Name |
1-Cyanoacetyl-3,5-dimethylpyrazole;3-(3,5-dimethyl-1H-pyrazol-1-yl)-3-oxopropanenitrile; 3-(3,5-dimethylpyrazol-1-yl)-3-oxopropanenitrile;
|
| Molekulare Formel |
C8H9N3O |
| Molecular Weight |
163.1766 |
| InChI |
InChI=1/C8H9N3O/c1-6-5-7(2)11(10-6)8(12)3-4-9/h5H,3H2,1-2H3 |
| CAS Registry Number |
36140-83-7 |
| Molecular Structure |
|
| Dichte |
1.16g/cm3 |
| Siedepunkt |
331.4°C at 760 mmHg |
| Brechungsindex |
1.572 |
| Flammpunkt |
154.2°C |
| Dampfdruck |
0.000156mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
