ChemNet > CAS > 36263-51-1 1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile
36263-51-1 1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile
| Produkt-Name |
1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile |
| Englischer Name |
1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile;1-(4-Methoxyphenyl)cyclohexanecarbonitrile |
| Molekulare Formel |
C14H17NO |
| Molecular Weight |
215.2909 |
| InChI |
InChI=1/C14H17NO/c1-16-13-7-5-12(6-8-13)14(11-15)9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3 |
| CAS Registry Number |
36263-51-1 |
| EINECS |
252-938-7 |
| Molecular Structure |
|
| Dichte |
1.06g/cm3 |
| Schmelzpunkt |
40-45℃ |
| Siedepunkt |
362°C at 760 mmHg |
| Brechungsindex |
1.538 |
| Flammpunkt |
152.6°C |
| Dampfdruck |
2E-05mmHg at 25°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
