ChemNet > CAS > 3658-48-8 bis(2-ethylhexyl) phosphite
3658-48-8 bis(2-ethylhexyl) phosphite
Produkt-Name |
bis(2-ethylhexyl) phosphite |
Englischer Name |
bis(2-ethylhexyl) phosphite; Bis-(2-ethylhexyl)-phosphite; bis(2-ethylhexyl) phosphonate; Phosphorous acid bis(2-ethylhexyl) ester; bis(2-ethylhexyl) hydrogen phosphite; bis[(2-ethylhexyl)oxy](oxo)phosphonium; Bis(2-ethylhexyl)phosphoric acid |
Molekulare Formel |
C16H34O3P |
Molecular Weight |
305.4126 |
InChI |
InChI=1/C16H34O3P/c1-5-9-11-15(7-3)13-18-20(17)19-14-16(8-4)12-10-6-2/h15-16H,5-14H2,1-4H3/q+1 |
CAS Registry Number |
3658-48-8 |
EINECS |
222-904-6 |
Molecular Structure |
|
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|