ChemNet > CAS > 3678-70-4 Diphenyl-2-pyridylmethane
3678-70-4 Diphenyl-2-pyridylmethane
| Produkt-Name |
Diphenyl-2-pyridylmethane |
| Englischer Name |
Diphenyl-2-pyridylmethane; 2-Diphenylmethylpyridine; 2-benzhydrylpyridine |
| Molekulare Formel |
C18H15N |
| Molecular Weight |
245.3184 |
| InChI |
InChI=1/C18H15N/c1-3-9-15(10-4-1)18(16-11-5-2-6-12-16)17-13-7-8-14-19-17/h1-14,18H |
| CAS Registry Number |
3678-70-4 |
| EINECS |
222-953-3 |
| Molecular Structure |
|
| Dichte |
1.085g/cm3 |
| Schmelzpunkt |
58-61℃ |
| Siedepunkt |
359.8°C at 760 mmHg |
| Brechungsindex |
1.607 |
| Flammpunkt |
153.6°C |
| Dampfdruck |
4.81E-05mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
