ChemNet > CAS > 368869-90-3 3-(2-Chlor-6-fluorphenyl)-N-(2-chlor-3-pyridinyl)-5-methyl-4-isoxazolcarboxamid
368869-90-3 3-(2-Chlor-6-fluorphenyl)-N-(2-chlor-3-pyridinyl)-5-methyl-4-isoxazolcarboxamid
| Produkt-Name |
3-(2-Chlor-6-fluorphenyl)-N-(2-chlor-3-pyridinyl)-5-methyl-4-isoxazolcarboxamid |
| Synonyme |
4-Fluorbenzolsulfonsäure; 3-(2-Chlor-6-fluorphenyl)-N-(2-chlorpyridin-3-yl)-5-methylisoxazol-4-carboxamid |
| Englischer Name |
3-(2-chloro-6-fluorophenyl)-N-(2-chloro-3-pyridinyl)-5-methyl-4-isoxazolecarboxamide;4-fluorobenzenesulfonic acid; 3-(2-chloro-6-fluorophenyl)-N-(2-chloropyridin-3-yl)-5-methylisoxazole-4-carboxamide |
| Molekulare Formel |
C16H10Cl2FN3O2 |
| Molecular Weight |
366.1739 |
| InChI |
InChI=1/C16H10Cl2FN3O2/c1-8-12(16(23)21-11-6-3-7-20-15(11)18)14(22-24-8)13-9(17)4-2-5-10(13)19/h2-7H,1H3,(H,21,23) |
| CAS Registry Number |
368869-90-3 |
| EINECS |
206-714-0 |
| Molecular Structure |
|
| Dichte |
1.481g/cm3 |
| Siedepunkt |
449.8°C at 760 mmHg |
| Brechungsindex |
1.634 |
| Flammpunkt |
225.8°C |
| Dampfdruck |
2.78E-08mmHg at 25°C |
| Gefahrensymbole |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|