ChemNet > CAS > 3766-55-0 4-Allylthiosemicarbazide
3766-55-0 4-Allylthiosemicarbazide
| Produkt-Name |
4-Allylthiosemicarbazide |
| Englischer Name |
4-Allylthiosemicarbazide; 4-Allyl-3-thiosemicarbazide; N-(prop-2-en-1-yl)hydrazinecarbothioamide |
| Molekulare Formel |
C4H9N3S |
| Molecular Weight |
131.1994 |
| InChI |
InChI=1/C4H9N3S/c1-2-3-6-4(8)7-5/h2H,1,3,5H2,(H2,6,7,8) |
| CAS Registry Number |
3766-55-0 |
| EINECS |
223-186-7 |
| Molecular Structure |
|
| Dichte |
1.131g/cm3 |
| Schmelzpunkt |
93-96℃ |
| Siedepunkt |
209.8°C at 760 mmHg |
| Brechungsindex |
1.575 |
| Flammpunkt |
80.7°C |
| Dampfdruck |
0.199mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
