ChemNet > CAS > 3773-14-6 2,4,5-Trichlorothiophenol
3773-14-6 2,4,5-Trichlorothiophenol
| Produkt-Name |
2,4,5-Trichlorothiophenol |
| Englischer Name |
2,4,5-Trichlorothiophenol; 2,4,5-Trichlorobenzenethiol; Trichlorothiophenol; 2,4,5-trichlorobenzenethiolate |
| Molekulare Formel |
C6H2Cl3S |
| Molecular Weight |
212.5046 |
| InChI |
InChI=1/C6H3Cl3S/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H/p-1 |
| CAS Registry Number |
3773-14-6 |
| EINECS |
223-223-7 |
| Molecular Structure |
|
| Schmelzpunkt |
117-118℃ |
| Siedepunkt |
283.2°C at 760 mmHg |
| Flammpunkt |
114.6°C |
| Dampfdruck |
0.0055mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
