ChemNet > CAS > 38226-10-7 6-Fluorosalicylaldehyde
38226-10-7 6-Fluorosalicylaldehyde
| Produkt-Name |
6-Fluorosalicylaldehyde |
| Englischer Name |
6-Fluorosalicylaldehyde; 2-Fluoro-6-hydroxybenzaldehyde |
| Molekulare Formel |
C7H5FO2 |
| Molecular Weight |
140.1118 |
| InChI |
InChI=1/C7H5FO2/c8-6-2-1-3-7(10)5(6)4-9/h1-4,10H |
| CAS Registry Number |
38226-10-7 |
| Molecular Structure |
|
| Dichte |
1.35g/cm3 |
| Siedepunkt |
201.3°C at 760 mmHg |
| Brechungsindex |
1.587 |
| Flammpunkt |
75.6°C |
| Dampfdruck |
0.218mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
