ChemNet > CAS > 3879-08-1 4-Hydroxybutyric acid hydrazide
3879-08-1 4-Hydroxybutyric acid hydrazide
| Produkt-Name |
4-Hydroxybutyric acid hydrazide |
| Englischer Name |
4-Hydroxybutyric acid hydrazide; 4-Hydroxybutanoic hydrazide; 4-hydroxybutanehydrazide |
| Molekulare Formel |
C4H10N2O2 |
| Molecular Weight |
118.1344 |
| InChI |
InChI=1/C4H10N2O2/c5-6-4(8)2-1-3-7/h7H,1-3,5H2,(H,6,8) |
| CAS Registry Number |
3879-08-1 |
| Molecular Structure |
|
| Dichte |
1.161g/cm3 |
| Schmelzpunkt |
92-93℃ |
| Siedepunkt |
377.5°C at 760 mmHg |
| Brechungsindex |
1.487 |
| Flammpunkt |
182.1°C |
| Dampfdruck |
3.03E-07mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
