ChemNet > CAS > 39101-54-7 3,5-Dimethylphenylacetonitrile
39101-54-7 3,5-Dimethylphenylacetonitrile
| Produkt-Name |
3,5-Dimethylphenylacetonitrile |
| Englischer Name |
3,5-Dimethylphenylacetonitrile; 3,5-Dimethylbenzyl cyanide; 2-(3,5-Dimethylphenyl)acetonitrile |
| Molekulare Formel |
C10H11N |
| Molecular Weight |
145.201 |
| InChI |
InChI=1/C10H11N/c1-8-5-9(2)7-10(6-8)3-4-11/h5-7H,3H2,1-2H3 |
| CAS Registry Number |
39101-54-7 |
| EINECS |
254-292-1 |
| Molecular Structure |
|
| Dichte |
0.979g/cm3 |
| Siedepunkt |
254.5°C at 760 mmHg |
| Brechungsindex |
1.524 |
| Flammpunkt |
117.5°C |
| Dampfdruck |
0.0172mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|
