ChemNet > CAS > 39244-10-5 3-(3-Furyl)acrylic acid
39244-10-5 3-(3-Furyl)acrylic acid
| Produkt-Name |
3-(3-Furyl)acrylic acid |
| Englischer Name |
3-(3-Furyl)acrylic acid; Furan-3-acrylic acid; (2E)-3-(furan-3-yl)prop-2-enoic acid; 3-Furanacrylic acid; 3-Furanylacrylic acid |
| Molekulare Formel |
C7H6O3 |
| Molecular Weight |
138.1207 |
| InChI |
InChI=1/C7H6O3/c8-7(9)2-1-6-3-4-10-5-6/h1-5H,(H,8,9)/b2-1+ |
| CAS Registry Number |
39244-10-5 |
| Molecular Structure |
|
| Dichte |
1.28g/cm3 |
| Siedepunkt |
261.4°C at 760 mmHg |
| Brechungsindex |
1.582 |
| Flammpunkt |
111.9°C |
| Dampfdruck |
0.00587mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
