ChemNet > CAS > 3943-73-5 ethyl 2,3-dihydroxybenzoate
3943-73-5 ethyl 2,3-dihydroxybenzoate
| Produkt-Name |
ethyl 2,3-dihydroxybenzoate |
| Englischer Name |
ethyl 2,3-dihydroxybenzoate; 2,3-Dihydroxy-benzoic acid ethyl ester |
| Molekulare Formel |
C9H10O4 |
| Molecular Weight |
182.1733 |
| InChI |
InChI=1/C9H10O4/c1-2-13-9(12)6-4-3-5-7(10)8(6)11/h3-5,10-11H,2H2,1H3 |
| CAS Registry Number |
3943-73-5 |
| Molecular Structure |
|
| Dichte |
1.294g/cm3 |
| Schmelzpunkt |
65℃ |
| Siedepunkt |
307.2°C at 760 mmHg |
| Brechungsindex |
1.573 |
| Flammpunkt |
123°C |
| Dampfdruck |
0.000406mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
