ChemNet > CAS > 3945-18-4 3,4-Di-O-acetyl-L-arabinal
3945-18-4 3,4-Di-O-acetyl-L-arabinal
| Produkt-Name |
3,4-Di-O-acetyl-L-arabinal |
| Englischer Name |
3,4-Di-O-acetyl-L-arabinal;2,3-di-O-acetyl-1,5-anhydro-4-deoxy-D-erythro-pent-4-enitol |
| Molekulare Formel |
C9H12O5 |
| Molecular Weight |
200.1886 |
| InChI |
InChI=1/C9H12O5/c1-6(10)13-8-3-4-12-5-9(8)14-7(2)11/h3-4,8-9H,5H2,1-2H3/t8-,9+/m1/s1 |
| CAS Registry Number |
3945-18-4 |
| Molecular Structure |
|
| Dichte |
1.2g/cm3 |
| Siedepunkt |
266.2°C at 760 mmHg |
| Brechungsindex |
1.476 |
| Flammpunkt |
112.8°C |
| Dampfdruck |
0.00878mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
