ChemNet > CAS > 39489-77-5 2,4-Dichloro-5-nitrophenol
39489-77-5 2,4-Dichloro-5-nitrophenol
| Produkt-Name |
2,4-Dichloro-5-nitrophenol |
| Englischer Name |
2,4-Dichloro-5-nitrophenol; |
| Molekulare Formel |
C6H3Cl2NO3 |
| Molecular Weight |
207.9989 |
| InChI |
InChI=1/C6H3Cl2NO3/c7-3-1-4(8)6(10)2-5(3)9(11)12/h1-2,10H |
| CAS Registry Number |
39489-77-5 |
| Molecular Structure |
|
| Dichte |
1.682g/cm3 |
| Siedepunkt |
311.2°C at 760 mmHg |
| Brechungsindex |
1.638 |
| Flammpunkt |
142°C |
| Dampfdruck |
0.000312mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
