ChemNet > CAS > 3964-57-6 Methyl 3-chloro-4-hydroxybenzoate
3964-57-6 Methyl 3-chloro-4-hydroxybenzoate
| Produkt-Name |
Methyl 3-chloro-4-hydroxybenzoate |
| Englischer Name |
Methyl 3-chloro-4-hydroxybenzoate; 3-Chloro-4-hydroxybenzoic acid methyl ester; Methyl 3-chloro-4-hydroxy benzoate |
| Molekulare Formel |
C8H7ClO3 |
| Molecular Weight |
186.5924 |
| InChI |
InChI=1/C8H7ClO3/c1-12-8(11)5-2-3-7(10)6(9)4-5/h2-4,10H,1H3 |
| CAS Registry Number |
3964-57-6 |
| EINECS |
223-573-0 |
| Molecular Structure |
|
| Dichte |
1.354g/cm3 |
| Schmelzpunkt |
106-107℃ |
| Siedepunkt |
284.9°C at 760 mmHg |
| Brechungsindex |
1.564 |
| Flammpunkt |
126.1°C |
| Dampfdruck |
0.00168mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
