ChemNet > CAS > 4004-95-9 1-Phenylpiperazin-Dihydrochlorid
4004-95-9 1-Phenylpiperazin-Dihydrochlorid
| Produkt-Name |
1-Phenylpiperazin-Dihydrochlorid |
| Synonyme |
1-Phenylpiperazin-Dihydrochlorid; 1-Phenylpiperazin HCl |
| Englischer Name |
1-phenylpiperazine dihydrochloride;1-Phenylpiperazine dihydrochloride; 1-Phenylpiperazine HCl |
| Molekulare Formel |
C10H16Cl2N2 |
| Molecular Weight |
235.1534 |
| InChI |
InChI=1/C10H14N2.2ClH/c1-2-4-10(5-3-1)12-8-6-11-7-9-12;;/h1-5,11H,6-9H2;2*1H |
| CAS Registry Number |
4004-95-9 |
| EINECS |
223-654-0 |
| Molecular Structure |
|
| Siedepunkt |
287.2°C at 760 mmHg |
| Flammpunkt |
138.3°C |
| Dampfdruck |
0.00252mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
