403-90-7 3-Fluoro-DL-tyrosine
Produkt-Name |
3-Fluoro-DL-tyrosine |
Englischer Name |
3-Fluoro-DL-tyrosine; H-DL-Tyr(3-F)-OH |
Molekulare Formel |
C9H10FNO3 |
Molecular Weight |
199.179 |
InChI |
InChI=1/C9H10FNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14)/t7-/m1/s1 |
CAS Registry Number |
403-90-7 |
EINECS |
206-964-0 |
Molecular Structure |
|
Dichte |
1.421g/cm3 |
Schmelzpunkt |
276-280℃ |
Siedepunkt |
362.4°C at 760 mmHg |
Brechungsindex |
1.591 |
Flammpunkt |
172.9°C |
Dampfdruck |
6.94E-06mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|