4143-62-8 3',4'-Dimethoxyflavone
Produkt-Name |
3',4'-Dimethoxyflavone |
Englischer Name |
3',4'-Dimethoxyflavone;2-(3,4-dimethoxyphenyl)-4H-chromen-4-one |
Molekulare Formel |
C17H14O4 |
Molecular Weight |
282.2907 |
InChI |
InChI=1/C17H14O4/c1-19-15-8-7-11(9-17(15)20-2)16-10-13(18)12-5-3-4-6-14(12)21-16/h3-10H,1-2H3 |
CAS Registry Number |
4143-62-8 |
Molecular Structure |
|
Dichte |
1.242g/cm3 |
Siedepunkt |
428.5°C at 760 mmHg |
Brechungsindex |
1.598 |
Flammpunkt |
190.6°C |
Dampfdruck |
1.51E-07mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|