4160-51-4 4'-methoxybutyrophenone
Produkt-Name |
4'-methoxybutyrophenone |
Englischer Name |
4'-methoxybutyrophenone; 1-(4-Methoxyphenyl)butan-1-on; 1-(4-Methoxyphenyl)butan-1-one; 1-Butanone, 1- (4-methoxyphenyl)-; 1-butanone, 1-(4-methoxyphenyl)-; 4'-Methoxy-butyrophenone; 4-Methoxybutyrophenone; Butyrophenone, 4'-methoxy-; p-Methoxybutyrophenone; 4-Butyrylanisole |
Molekulare Formel |
C11H14O2 |
Molecular Weight |
178.2277 |
InChI |
InChI=1/C11H14O2/c1-3-4-11(12)9-5-7-10(13-2)8-6-9/h5-8H,3-4H2,1-2H3 |
CAS Registry Number |
4160-51-4 |
EINECS |
223-995-5 |
Molecular Structure |
|
Dichte |
1.001g/cm3 |
Siedepunkt |
288.3°C at 760 mmHg |
Brechungsindex |
1.498 |
Flammpunkt |
124.3°C |
Dampfdruck |
0.00236mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|