ChemNet > CAS > 42048-11-3 2-Chloro-6-iodotoluene
42048-11-3 2-Chloro-6-iodotoluene
| Produkt-Name |
2-Chloro-6-iodotoluene |
| Englischer Name |
2-Chloro-6-iodotoluene; 1-Chloro-3-iodo-2-methylbenzene; 2-Iodo-6-chlorotoluene |
| Molekulare Formel |
C7H6ClI |
| Molecular Weight |
252.48 |
| InChI |
InChI=1/C7H6ClI/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| CAS Registry Number |
42048-11-3 |
| Molecular Structure |
|
| Dichte |
1.806g/cm3 |
| Siedepunkt |
243°C at 760 mmHg |
| Brechungsindex |
1.616 |
| Flammpunkt |
100.8°C |
| Dampfdruck |
0.0513mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
