ChemNet > CAS > 42066-86-4 2-isocyanatobenzonitrile
42066-86-4 2-isocyanatobenzonitrile
| Produkt-Name |
2-isocyanatobenzonitrile |
| Englischer Name |
2-isocyanatobenzonitrile; 2-Cyanophenyl isocyanate |
| Molekulare Formel |
C8H4N2O |
| Molecular Weight |
144.1302 |
| InChI |
InChI=1/C8H4N2O/c9-5-7-3-1-2-4-8(7)10-6-11/h1-4H |
| CAS Registry Number |
42066-86-4 |
| Molecular Structure |
|
| Dichte |
1.09g/cm3 |
| Schmelzpunkt |
59℃ |
| Siedepunkt |
266.2°C at 760 mmHg |
| Brechungsindex |
1.562 |
| Flammpunkt |
114.8°C |
| Dampfdruck |
0.00875mmHg at 25°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
