ChemNet > CAS > 43020-38-8 2,3,4-Trimethoxybenzonitrile
43020-38-8 2,3,4-Trimethoxybenzonitrile
| Produkt-Name |
2,3,4-Trimethoxybenzonitrile |
| Englischer Name |
2,3,4-Trimethoxybenzonitrile; |
| Molekulare Formel |
C10H11NO3 |
| Molecular Weight |
193.1992 |
| InChI |
InChI=1/C10H11NO3/c1-12-8-5-4-7(6-11)9(13-2)10(8)14-3/h4-5H,1-3H3 |
| CAS Registry Number |
43020-38-8 |
| EINECS |
256-049-5 |
| Molecular Structure |
|
| Dichte |
1.15g/cm3 |
| Schmelzpunkt |
55-57℃ |
| Siedepunkt |
311.1°C at 760 mmHg |
| Brechungsindex |
1.514 |
| Flammpunkt |
127.8°C |
| Dampfdruck |
0.000576mmHg at 25°C |
| Gefahrensymbole |
 T:Toxic;
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
