| Produkt-Name |
D-Gluconsäure, Verbindung mit (8α,9R)-6'-methoxycinchonan-9-ol (1:1) |
| Synonyme |
Chiningluconat; D-Gluconsäure, Verbindung mit (8alpha,9R)-6'-methoxycinchonan-9-ol (1:1); 6'-Methoxycinchonan-9-ol-D-Gluconsäure (1:1) |
| Englischer Name |
D-gluconic acid, compound with (8α,9R)-6'-methoxycinchonan-9-ol (1:1);Quinine gluconate; D-Gluconic acid, compound with (8alpha,9R)-6'-methoxycinchonan-9-ol (1:1); 6'-methoxycinchonan-9-ol - D-gluconic acid (1:1) |
| Molekulare Formel |
C26H36N2O9 |
| Molecular Weight |
520.572 |
| InChI |
InChI=1/C20H24N2O2.C6H12O7/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;7-1-2(8)3(9)4(10)5(11)6(12)13/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;2-5,7-11H,1H2,(H,12,13)/t;2-,3-,4+,5-/m.1/s1 |
| CAS Registry Number |
4325-25-1 |
| EINECS |
224-358-4 |
| Molecular Structure |
|
| Siedepunkt |
495.9°C at 760 mmHg |
| Flammpunkt |
253.7°C |
| Dampfdruck |
1.19E-10mmHg at 25°C |
|