ChemNet > CAS > 4347-31-3 2-Formylthiophene-3-boronic acid
4347-31-3 2-Formylthiophene-3-boronic acid
| Produkt-Name |
2-Formylthiophene-3-boronic acid |
| Englischer Name |
2-Formylthiophene-3-boronic acid; 3-Boronothiophene-2-carboxaldehyde; (2-Formyl-3-thienyl)boronic acid; (2-formylthiophen-3-yl)boronic acid |
| Molekulare Formel |
C5H5BO3S |
| Molecular Weight |
155.9674 |
| InChI |
InChI=1/C5H5BO3S/c7-3-5-4(6(8)9)1-2-10-5/h1-3,8-9H |
| CAS Registry Number |
4347-31-3 |
| Molecular Structure |
|
| Dichte |
1.41g/cm3 |
| Schmelzpunkt |
167-173℃ |
| Siedepunkt |
396.7°C at 760 mmHg |
| Brechungsindex |
1.573 |
| Flammpunkt |
193.7°C |
| Dampfdruck |
5.27E-07mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
