ChemNet > CAS > 4437-85-8 4-Ethyl-1,3-dioxolan-2-on
4437-85-8 4-Ethyl-1,3-dioxolan-2-on
| Produkt-Name |
4-Ethyl-1,3-dioxolan-2-on |
| Synonyme |
Butylencarbonat; (4S)-4-ethyl-1,3-dioxolan-2-on; (4R)-4-ethyl-1,3-dioxolan-2-on; 4-(Carboxyoxy)butylcarbonat |
| Englischer Name |
4-Ethyl-1,3-dioxolan-2-one; Butylene carbonate; (4S)-4-ethyl-1,3-dioxolan-2-one; (4R)-4-ethyl-1,3-dioxolan-2-one; 4-(carboxyoxy)butyl carbonate |
| Molekulare Formel |
C6H9O6 |
| Molecular Weight |
177.1326 |
| InChI |
InChI=1/C6H10O6/c7-5(8)11-3-1-2-4-12-6(9)10/h1-4H2,(H,7,8)(H,9,10)/p-1 |
| CAS Registry Number |
4437-85-8 |
| Molecular Structure |
|
| Siedepunkt |
361.205°C at 760 mmHg |
| Flammpunkt |
152.029°C |
| Dampfdruck |
0mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|