454-29-5 DL-Homocysteine
Produkt-Name |
DL-Homocysteine |
Englischer Name |
DL-Homocysteine; DL-Homocysteine 2-Amino-4-mercaptobuyric acid; homocysteine; D-homocysteine |
Molekulare Formel |
C4H9NO2S |
Molecular Weight |
135.1848 |
InChI |
InChI=1/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m1/s1 |
CAS Registry Number |
454-29-5 |
EINECS |
207-222-9 |
Molecular Structure |
|
Dichte |
1.259g/cm3 |
Schmelzpunkt |
232-233℃ |
Siedepunkt |
299.7°C at 760 mmHg |
Brechungsindex |
1.537 |
Flammpunkt |
135°C |
Dampfdruck |
0.000278mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|