ChemNet > CAS > 455-84-5 4-Fluoro-3-methylbenzoyl chloride
455-84-5 4-Fluoro-3-methylbenzoyl chloride
Produkt-Name |
4-Fluoro-3-methylbenzoyl chloride |
Englischer Name |
4-Fluoro-3-methylbenzoyl chloride; 4-Fluoro-m-toluoyl chloride |
Molekulare Formel |
C8H6ClFO |
Molecular Weight |
172.584 |
InChI |
InChI=1/C8H6ClFO/c1-5-4-6(8(9)11)2-3-7(5)10/h2-4H,1H3 |
CAS Registry Number |
455-84-5 |
Molecular Structure |
|
Dichte |
1.265g/cm3 |
Siedepunkt |
214.1°C at 760 mmHg |
Brechungsindex |
1.518 |
Flammpunkt |
83.3°C |
Dampfdruck |
0.158mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R34:Causes burns.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|