ChemNet > CAS > 459-05-2 1-(4-fluorophenyl)-2-thiourea
459-05-2 1-(4-fluorophenyl)-2-thiourea
Produkt-Name |
1-(4-fluorophenyl)-2-thiourea |
Englischer Name |
1-(4-fluorophenyl)-2-thiourea; 4-Fluorophenylthiourea; 1-(4-fluorophenyl)thiourea |
Molekulare Formel |
C7H7FN2S |
Molecular Weight |
170.2073 |
InChI |
InChI=1/C7H7FN2S/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
CAS Registry Number |
459-05-2 |
Molecular Structure |
|
Dichte |
1.397g/cm3 |
Schmelzpunkt |
164℃ |
Siedepunkt |
264.2°C at 760 mmHg |
Brechungsindex |
1.692 |
Flammpunkt |
113.6°C |
Dampfdruck |
0.00987mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R25:Toxic if swallowed.;
|
Safety Beschreibung |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|