ChemNet > CAS > 4685-47-6 3,4-Dimethylanisole
4685-47-6 3,4-Dimethylanisole
| Produkt-Name |
3,4-Dimethylanisole |
| Englischer Name |
3,4-Dimethylanisole; 1,2-Dimethyl-4-methoxybenzene; 4-Methoxy-o-xylene; 3-(methoxycarbonyl)-1-methylpyridinium; 4-methoxy-1,2-dimethyl-benzene |
| Molekulare Formel |
C9H12O |
| Molecular Weight |
136.191 |
| InChI |
InChI=1/C9H12O/c1-7-4-5-9(10-3)6-8(7)2/h4-6H,1-3H3 |
| CAS Registry Number |
4685-47-6 |
| EINECS |
225-142-2 |
| Molecular Structure |
|
| Dichte |
0.932g/cm3 |
| Siedepunkt |
203.1°C at 760 mmHg |
| Brechungsindex |
1.495 |
| Flammpunkt |
75.6°C |
| Dampfdruck |
0.402mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
