4685-47-6 3,4-Dimethylanisole
Produkt-Name |
3,4-Dimethylanisole |
Englischer Name |
3,4-Dimethylanisole; 1,2-Dimethyl-4-methoxybenzene; 4-Methoxy-o-xylene; 3-(methoxycarbonyl)-1-methylpyridinium; 4-methoxy-1,2-dimethyl-benzene |
Molekulare Formel |
C9H12O |
Molecular Weight |
136.191 |
InChI |
InChI=1/C9H12O/c1-7-4-5-9(10-3)6-8(7)2/h4-6H,1-3H3 |
CAS Registry Number |
4685-47-6 |
EINECS |
225-142-2 |
Molecular Structure |
|
Dichte |
0.932g/cm3 |
Siedepunkt |
203.1°C at 760 mmHg |
Brechungsindex |
1.495 |
Flammpunkt |
75.6°C |
Dampfdruck |
0.402mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|