ChemNet > CAS > 488-87-9 2,5-Dimethylresorcin
488-87-9 2,5-Dimethylresorcin
| Produkt-Name |
2,5-Dimethylresorcin |
| Synonyme |
2,5-Dimethylbenzol-1,3-diol |
| Englischer Name |
2,5-Dimethylresorcinol;2,5-dimethylbenzene-1,3-diol |
| Molekulare Formel |
C8H10O2 |
| Molecular Weight |
138.1638 |
| InChI |
InChI=1/C8H10O2/c1-5-3-7(9)6(2)8(10)4-5/h3-4,9-10H,1-2H3 |
| CAS Registry Number |
488-87-9 |
| EINECS |
207-688-3 |
| Molecular Structure |
|
| Dichte |
1.162g/cm3 |
| Schmelzpunkt |
161℃ |
| Siedepunkt |
284.1°C at 760 mmHg |
| Brechungsindex |
1.582 |
| Flammpunkt |
140.8°C |
| Dampfdruck |
0.00178mmHg at 25°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
