4906-24-5 3-Acetoxy-2-butanone
Produkt-Name |
3-Acetoxy-2-butanone |
Englischer Name |
3-Acetoxy-2-butanone; Acetoin acetate; 3-oxobutan-2-yl acetate; 2-Acetoxy-3-butanone |
Molekulare Formel |
C6H10O3 |
Molecular Weight |
130.1418 |
InChI |
InChI=1/C6H10O3/c1-4(7)5(2)9-6(3)8/h5H,1-3H3 |
CAS Registry Number |
4906-24-5 |
Molecular Structure |
|
Dichte |
1.012g/cm3 |
Siedepunkt |
163.4°C at 760 mmHg |
Brechungsindex |
1.406 |
Flammpunkt |
56.6°C |
Dampfdruck |
2.07mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|