ChemNet > CAS > 4916-57-8 1,2-Bis(4-pyridyl)ethane
4916-57-8 1,2-Bis(4-pyridyl)ethane
| Produkt-Name |
1,2-Bis(4-pyridyl)ethane |
| Englischer Name |
1,2-Bis(4-pyridyl)ethane; |
| Molekulare Formel |
C12H12N2 |
| Molecular Weight |
184.2371 |
| InChI |
InChI=1/C12H12N2/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12/h3-10H,1-2H2 |
| CAS Registry Number |
4916-57-8 |
| EINECS |
225-543-2 |
| Molecular Structure |
|
| Dichte |
1.087g/cm3 |
| Schmelzpunkt |
107-113℃ |
| Siedepunkt |
310.3°C at 760 mmHg |
| Brechungsindex |
1.581 |
| Flammpunkt |
117.2°C |
| Dampfdruck |
0.00111mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
