ChemNet > CAS > 4920-34-7 2,3,6-Trifluoroanisole
4920-34-7 2,3,6-Trifluoroanisole
| Produkt-Name |
2,3,6-Trifluoroanisole |
| Englischer Name |
2,3,6-Trifluoroanisole; 3-Methoxy-1,2,4-trifluorobenzene; 1,2,4-trifluoro-3-methoxybenzene |
| Molekulare Formel |
C7H5F3O |
| Molecular Weight |
162.1092 |
| InChI |
InChI=1/C7H5F3O/c1-11-7-5(9)3-2-4(8)6(7)10/h2-3H,1H3 |
| CAS Registry Number |
4920-34-7 |
| Molecular Structure |
|
| Dichte |
1.285g/cm3 |
| Siedepunkt |
147.7°C at 760 mmHg |
| Brechungsindex |
1.435 |
| Flammpunkt |
49.1°C |
| Dampfdruck |
5.53mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R10:Flammable.;
|
| Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
