ChemNet > CAS > 496-46-8 Glycoluril
496-46-8 Glycoluril
| Produkt-Name |
Glycoluril |
| Englischer Name |
Glycoluril; Acetyleneurea; Tetrahydroimidazo[4,5-d]imidazole-2,5-(1H,3H)-dione; perhydroimidazo(4,5-d)imidazole-2,5-dione; di-1,2-ureyleneethane |
| Molekulare Formel |
C4H6N4O2 |
| Molecular Weight |
142.116 |
| InChI |
InChI=1/C4H6N4O2/c9-3-5-1-2(7-3)8-4(10)6-1/h1-2H,(H2,5,7,9)(H2,6,8,10) |
| CAS Registry Number |
496-46-8 |
| EINECS |
207-821-5 |
| Molecular Structure |
|
| Dichte |
1.42g/cm3 |
| Schmelzpunkt |
>300℃ |
| Siedepunkt |
861.6°C at 760 mmHg |
| Brechungsindex |
1.514 |
| Flammpunkt |
421.8°C |
| Dampfdruck |
4.61E-30mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
