50-66-8 6-(Methylthio)purine
Produkt-Name |
6-(Methylthio)purine |
Englischer Name |
6-(Methylthio)purine; 6-(Methylmercapto)purine; 6-(Methylsulfanyl)-9H-purine; 6-(methylsulfanyl)-7H-purine; 6-(methylsulfanyl)-5H-purine |
Molekulare Formel |
C6H6N4S |
Molecular Weight |
166.2036 |
InChI |
InChI=1/C6H6N4S/c1-11-6-4-5(8-2-7-4)9-3-10-6/h2-4H,1H3 |
CAS Registry Number |
50-66-8 |
EINECS |
200-057-3 |
Molecular Structure |
|
Dichte |
1.59g/cm3 |
Schmelzpunkt |
221-222℃ |
Siedepunkt |
290.9°C at 760 mmHg |
Brechungsindex |
1.806 |
Flammpunkt |
129.7°C |
Dampfdruck |
0.00351mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|