50262-67-4 p-Nonyloxyaniline
| Produkt-Name |
p-Nonyloxyaniline |
| Englischer Name |
p-Nonyloxyaniline; 4-n-Nonyloxyaniline; 4-(nonyloxy)aniline |
| Molekulare Formel |
C15H25NO |
| Molecular Weight |
235.3651 |
| InChI |
InChI=1/C15H25NO/c1-2-3-4-5-6-7-8-13-17-15-11-9-14(16)10-12-15/h9-12H,2-8,13,16H2,1H3 |
| CAS Registry Number |
50262-67-4 |
| Molecular Structure |
|
| Dichte |
0.949g/cm3 |
| Siedepunkt |
356.5°C at 760 mmHg |
| Brechungsindex |
1.511 |
| Flammpunkt |
159.3°C |
| Dampfdruck |
2.91E-05mmHg at 25°C |
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|