ChemNet > CAS > 51304-58-6 4-Cyano-4-phenylpiperidine hydrochloride
51304-58-6 4-Cyano-4-phenylpiperidine hydrochloride
| Produkt-Name |
4-Cyano-4-phenylpiperidine hydrochloride |
| Englischer Name |
4-Cyano-4-phenylpiperidine hydrochloride; 4-Phenyl-4-piperidinecarbonitrile.HCl; 4-Cyano-4-phenylpiperidine. HCl; 4-phenylpiperidine-4-carbonitrile hydrochloride |
| Molekulare Formel |
C12H15N2 |
| Molecular Weight |
187.2604 |
| InChI |
InChI=1/C12H14N2/c13-10-12(6-8-14-9-7-12)11-4-2-1-3-5-11/h1-5,14H,6-9H2/p+1 |
| CAS Registry Number |
51304-58-6 |
| EINECS |
257-124-5 |
| Molecular Structure |
|
| Schmelzpunkt |
210-214℃ |
| Siedepunkt |
344.6°C at 760 mmHg |
| Flammpunkt |
162.2°C |
| Dampfdruck |
6.52E-05mmHg at 25°C |
| Gefahrensymbole |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|