51801-69-5 4-(m-Tolyloxy)-toluene
Produkt-Name |
4-(m-Tolyloxy)-toluene |
Englischer Name |
4-(m-Tolyloxy)-toluene; 3,4-Dimethyldiphenyl ether; 1-methyl-3-(4-methylphenoxy)benzene |
Molekulare Formel |
C14H14O |
Molecular Weight |
198.2604 |
InChI |
InChI=1/C14H14O/c1-11-6-8-13(9-7-11)15-14-5-3-4-12(2)10-14/h3-10H,1-2H3 |
CAS Registry Number |
51801-69-5 |
Molecular Structure |
|
Dichte |
1.029g/cm3 |
Siedepunkt |
285.8°C at 760 mmHg |
Brechungsindex |
1.56 |
Flammpunkt |
121.5°C |
Dampfdruck |
0.00471mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|