ChemNet > CAS > 5197-28-4 2-Bromo-4-nitroanisole
5197-28-4 2-Bromo-4-nitroanisole
| Produkt-Name |
2-Bromo-4-nitroanisole |
| Englischer Name |
2-Bromo-4-nitroanisole;Anisole, 2-bromo-4-nitro-; 2-bromo-1-methoxy-4-nitrobenzene |
| Molekulare Formel |
C7H6BrNO3 |
| Molecular Weight |
232.0314 |
| InChI |
InChI=1/C7H6BrNO3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,1H3 |
| CAS Registry Number |
5197-28-4 |
| EINECS |
225-983-5 |
| Molecular Structure |
|
| Dichte |
1.64g/cm3 |
| Schmelzpunkt |
104-106℃ |
| Siedepunkt |
306.3°C at 760 mmHg |
| Brechungsindex |
1.581 |
| Flammpunkt |
139.1°C |
| Dampfdruck |
0.00141mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
