5211-62-1 2-Methoxyphenylacetone
Produkt-Name |
2-Methoxyphenylacetone |
Englischer Name |
2-Methoxyphenylacetone; 2-Methoxybenzyl methyl ketone; 1-(2-Methoxyphenyl)-2-propanone; 1-(2-methoxyphenyl)propan-2-one |
Molekulare Formel |
C10H12O2 |
Molecular Weight |
164.2011 |
InChI |
InChI=1/C10H12O2/c1-8(11)7-9-5-3-4-6-10(9)12-2/h3-6H,7H2,1-2H3 |
CAS Registry Number |
5211-62-1 |
EINECS |
226-008-6 |
Molecular Structure |
|
Dichte |
1.027g/cm3 |
Schmelzpunkt |
127-130℃ (10 mmHg) |
Siedepunkt |
261.7°C at 760 mmHg |
Brechungsindex |
1.501 |
Flammpunkt |
94°C |
Dampfdruck |
0.0114mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|