ChemNet > CAS > 52287-51-1 3,4-Ethylenedioxybromobenzene
52287-51-1 3,4-Ethylenedioxybromobenzene
| Produkt-Name |
3,4-Ethylenedioxybromobenzene |
| Englischer Name |
3,4-Ethylenedioxybromobenzene; 3,4-(Ethylenedioxy)bromobenzene; 6-Bromo-1,4-benzodioxane; 6-Bromo-2,3-dihydro-1,4-benzodioxine |
| Molekulare Formel |
C8H7BrO2 |
| Molecular Weight |
215.044 |
| InChI |
InChI=1/C8H7BrO2/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-2,5H,3-4H2 |
| CAS Registry Number |
52287-51-1 |
| EINECS |
257-817-2 |
| Molecular Structure |
|
| Dichte |
1.598g/cm3 |
| Siedepunkt |
258.299°C at 760 mmHg |
| Brechungsindex |
1.579 |
| Flammpunkt |
117.638°C |
| Dampfdruck |
0.022mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
