ChemNet > CAS > 52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
| Produkt-Name |
2,5-Dibromo-3,4-dinitrothiophene |
| Englischer Name |
2,5-Dibromo-3,4-dinitrothiophene; 2,5-Dibromo-3,4-dinitrthiphene; AKOS 92299; 2,5-DIBROMO-3,4-DINITROTHIOPHENE 98+% |
| Molekulare Formel |
C4Br2N2O4S |
| Molecular Weight |
331.9268 |
| InChI |
InChI=1/C4Br2N2O4S/c5-3-1(7(9)10)2(8(11)12)4(6)13-3 |
| CAS Registry Number |
52431-30-8 |
| Molecular Structure |
|
| Dichte |
2.459g/cm3 |
| Siedepunkt |
341.2°C at 760 mmHg |
| Brechungsindex |
1.716 |
| Flammpunkt |
160.2°C |
| Dampfdruck |
0.000161mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
