525-82-6 Flavone
Produkt-Name |
Flavone |
Englischer Name |
Flavone; 2-Phenyl-4H-1-benzopyran-4-one; 2-Phenylchromone; Flavone(2-Phenylchromone); 2-phenyl-4H-chromen-4-one |
Molekulare Formel |
C15H10O2 |
Molecular Weight |
222.2387 |
InChI |
InChI=1/C15H10O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-10H |
CAS Registry Number |
525-82-6 |
EINECS |
208-383-8 |
Molecular Structure |
|
Dichte |
1.239g/cm3 |
Schmelzpunkt |
96-98℃ |
Siedepunkt |
367°C at 760 mmHg |
Brechungsindex |
1.635 |
Flammpunkt |
171.1°C |
Dampfdruck |
1.41E-05mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|