ChemNet > CAS > 53760-27-3 4,4'-Diaminodiphenylamine sulfate
53760-27-3 4,4'-Diaminodiphenylamine sulfate
Produkt-Name |
4,4'-Diaminodiphenylamine sulfate |
Englischer Name |
4,4'-Diaminodiphenylamine sulfate; 4,4-Diaminophenylamine sulfate; 4,4-Iminodianiline sulfate salt; N-(4-aminophenyl)benzene-1,4-diamine; N-(4-aminophenyl)benzene-1,4-diamine sulfate (1:1); N-(4-Aminophenyl)-1,4-benzenediamine |
Molekulare Formel |
C12H13N3O4S |
Molecular Weight |
295.3154 |
InChI |
InChI=1/C12H13N3.H2O4S/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;1-5(2,3)4/h1-8,15H,13-14H2;(H2,1,2,3,4)/p-2 |
CAS Registry Number |
53760-27-3 |
EINECS |
258-748-0 |
Molecular Structure |
|
Schmelzpunkt |
300℃ |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|