ChemNet > CAS > 5381-20-4 thianaphthene-3-carboxaldehyde
5381-20-4 thianaphthene-3-carboxaldehyde
| Produkt-Name |
thianaphthene-3-carboxaldehyde |
| Englischer Name |
thianaphthene-3-carboxaldehyde; 1-Benzothiophene-3-carbaldehyde; Benzo[b]thiophene-3-carboxaldehyde |
| Molekulare Formel |
C9H6OS |
| Molecular Weight |
162.2083 |
| InChI |
InChI=1/C9H6OS/c10-5-7-6-11-9-4-2-1-3-8(7)9/h1-6H |
| CAS Registry Number |
5381-20-4 |
| Molecular Structure |
|
| Dichte |
1.3g/cm3 |
| Schmelzpunkt |
56-58℃ |
| Siedepunkt |
303.2°C at 760 mmHg |
| Brechungsindex |
1.719 |
| Flammpunkt |
137.2°C |
| Dampfdruck |
0.000944mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
