ChemNet > CAS > 5381-99-7 2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one
5381-99-7 2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one
| Produkt-Name |
2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one |
| Englischer Name |
2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one; 2-Chloro-1,3,2-benzodioxaphosphorin-4-one; ChloroHbenzodioxaphosphorinone; 2-chloro-4H-1,3,2-benzodioxaphosphinin-4-one |
| Molekulare Formel |
C7H4ClO3P |
| Molecular Weight |
202.5316 |
| InChI |
InChI=1/C7H4ClO3P/c8-12-10-6-4-2-1-3-5(6)7(9)11-12/h1-4H |
| CAS Registry Number |
5381-99-7 |
| Molecular Structure |
|
| Schmelzpunkt |
36-128℃ |
| Siedepunkt |
257.8°C at 760 mmHg |
| Flammpunkt |
109.7°C |
| Dampfdruck |
0.0142mmHg at 25°C |
| Gefahrensymbole |
 C:Corrosive;
|
| Risk Codes |
R14:Reacts violently with water.;
R34:Causes burns.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S8:Keep container dry.;
|
|
