ChemNet > CAS > 5393-99-7 4,5-Diphenyl-1,2,3-thiadiazole
5393-99-7 4,5-Diphenyl-1,2,3-thiadiazole
| Produkt-Name |
4,5-Diphenyl-1,2,3-thiadiazole |
| Englischer Name |
4,5-Diphenyl-1,2,3-thiadiazole; |
| Molekulare Formel |
C14H10N2S |
| Molecular Weight |
238.3076 |
| InChI |
InChI=1/C14H10N2S/c1-3-7-11(8-4-1)13-14(17-16-15-13)12-9-5-2-6-10-12/h1-10H |
| CAS Registry Number |
5393-99-7 |
| Molecular Structure |
|
| Dichte |
1.216g/cm3 |
| Siedepunkt |
361.2°C at 760 mmHg |
| Brechungsindex |
1.633 |
| Flammpunkt |
161.9°C |
| Dampfdruck |
4.38E-05mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
