541-88-8 Chloroacetic anhydride
Produkt-Name |
Chloroacetic anhydride |
Englischer Name |
Chloroacetic anhydride;Chloracetic anhydride; 2-Chloroacetic anhydride; AI3-52321; Acetic acid, chloro-, anhydride; Chloroacetic acid anhydride; Chloroacetyl anhydride; Chloroethanoic anhydride; HSDB 5685; Monochloroacetic acid anhydride; NSC 71207; Sym-dichloroacetic anhydride; alpha,alpha'-Dichloroacetic anhydride; Acetic acid, 2-chloro-, 1,1'-anhydride; methyl 3-chloro-4-fluorobutanoate; (2-chloroacetyl) 2-chloroacetate |
Molekulare Formel |
C4H4Cl2O3 |
Molecular Weight |
170.9788 |
InChI |
InChI=1/C4H4Cl2O3/c5-1-3(7)9-4(8)2-6/h1-2H2 |
CAS Registry Number |
541-88-8 |
EINECS |
208-794-2 |
Molecular Structure |
|
Dichte |
1.449g/cm3 |
Schmelzpunkt |
54-58℃ |
Siedepunkt |
203°C at 760 mmHg |
Brechungsindex |
1.456 |
Flammpunkt |
82.8°C |
Dampfdruck |
0.284mmHg at 25°C |
Gefahrensymbole |
T:Toxic;
|
Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R35:Causes severe burns.;
|
Safety Beschreibung |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|