543-20-4 Succinyl chloride
Produkt-Name |
Succinyl chloride |
Englischer Name |
Succinyl chloride; Succinic acid dichloride; Succinyl dichloride; Succinoyl dichloride; Butanedioyl dichloride |
Molekulare Formel |
C4H4Cl2O2 |
Molecular Weight |
154.9794 |
InChI |
InChI=1/C4H4Cl2O2/c5-3(7)1-2-4(6)8/h1-2H2 |
CAS Registry Number |
543-20-4 |
EINECS |
208-838-0 |
Molecular Structure |
|
Dichte |
1.389g/cm3 |
Schmelzpunkt |
16-17℃ |
Siedepunkt |
193.4°C at 760 mmHg |
Brechungsindex |
1.456 |
Flammpunkt |
76.7°C |
Dampfdruck |
0.466mmHg at 25°C |
Gefahrensymbole |
C:Corrosive;
|
Risk Codes |
R34:Causes burns.;
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|